|
|
| | 3-Bromobenzenesulfonyl chloride Basic information |
| | 3-Bromobenzenesulfonyl chloride Chemical Properties |
| Melting point | 30-33 °C | | Boiling point | 90-91 °C/0.5 mmHg (lit.) | | density | 1.773 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.593(lit.) | | Fp | >110 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Liquid | | color | Clear colorless to yellow | | Sensitive | Moisture Sensitive | | BRN | 2691656 | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C6H4BrClO2S/c7-5-2-1-3-6(4-5)11(8,9)10/h1-4H | | InChIKey | PJGOLCXVWIYXRQ-UHFFFAOYSA-N | | SMILES | C1(S(Cl)(=O)=O)=CC=CC(Br)=C1 | | CAS DataBase Reference | 2905-24-0(CAS DataBase Reference) |
| Hazard Codes | C,Xn | | Risk Statements | 34-36/37/38-20/21/22 | | Safety Statements | 26-36/37/39-45-36 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Moisture Sensitive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 |
| | 3-Bromobenzenesulfonyl chloride Usage And Synthesis |
| Chemical Properties | clear colorless to yellow liquid | | Uses | 3-Bromobenzenesulfonyl chloride may be used in the preparation of:
- 2-(3-bromophenyl)-5-n-butylfuran
- 2-(3-bromophenyl)-3,6-dimethyl-4,5,6,7-tetrahydrobenzofuran
- 3-bromo-4-(3-bromophenyl)thiophene
- 2,5-bis(3-bromophenyl)-1-methylpyrrole
| | General Description | 3-Bromobenzenesulfonyl chloride is an aryl sulfonyl chloride derivative. It participates in the synthesis of N-sulfonylanthranilic acid derivatives and potent P1′ benzenesulfonyl azacyclic urea human immunodeficiency virus (HIV) protease inhibitors. |
| | 3-Bromobenzenesulfonyl chloride Preparation Products And Raw materials |
|