- 1,4-DICHLOROANTHRAQUINONE
-
- $25.00 / 1ASSAYS
-
2026-01-05
- CAS:602-25-5
- Min. Order: 100ASSAYS
- Purity: 99.5%
- Supply Ability: 100 mt
- 1,4-Dichloroanthraquinone
-
- $15.00 / 1KG
-
2021-07-02
- CAS:602-25-5
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 1,4-DICHLOROANTHRAQUINONE Basic information |
| Product Name: | 1,4-DICHLOROANTHRAQUINONE | | Synonyms: | 1,4-DICHLOROANTHRAQUINONE;1,4-Dichloro-9,10-anthracenedione;1,4-Dichloro-9,10-dihydro-9,10-dioxoanthracene;1,4-dichloroanthracene-9,10-dione;1,4-Dichloro-9,10-anthraquinone;1,4-Dichloroanthraquinone>;9,10-Anthracenedione, 1,4-dichloro-;1,4-DICHLOROANTHRAQUINONE ISO 9001：2015 REACH | | CAS: | 602-25-5 | | MF: | C14H6Cl2O2 | | MW: | 277.1 | | EINECS: | | | Product Categories: | Intermediates of Dyes and Pigments;Anthraquinones;Chloroanthraquine, etc. | | Mol File: | 602-25-5.mol |  |
| | 1,4-DICHLOROANTHRAQUINONE Chemical Properties |
| Melting point | 187-189 °C(lit.) | | Boiling point | 455.2±45.0 °C(Predicted) | | density | 1.514±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | Light yellow to Brown | | InChI | InChI=1S/C14H6Cl2O2/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-6H | | InChIKey | CAHGWVAXFJXDNI-UHFFFAOYSA-N | | SMILES | C1(Cl)=C2C(C(=O)C3=C(C2=O)C=CC=C3)=C(Cl)C=C1 | | CAS DataBase Reference | 602-25-5 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2914.69.9000 |
| | 1,4-DICHLOROANTHRAQUINONE Usage And Synthesis |
| Chemical Properties | Orange-yellow needle-like crystals. Melting point 187.5 ℃. Slightly soluble in ethanol, ether and petroleum, soluble in nitrobenzene, pyridine, hot benzene and acetic acid. | | Uses | 1,4-Dichloroanthraquinone can be used to synthesize vat brown BR and dye intermediates. | | Synthesis | 1,4-Dichloroanthraquinone is obtained by condensation and oxidation of phthalide and p-dichlorobenzene in the presence of aluminum trichloride. |
| | 1,4-DICHLOROANTHRAQUINONE Preparation Products And Raw materials |
|