- (1R)-(+)-NOPINONE
-
- $0.00 / 1KG
-
2022-01-18
- CAS:38651-65-9
- Min. Order: 1KG
- Purity: 97.8%
- Supply Ability: 100 tons
- (1R)-(+)-Nopinone
-
- $15.00 / 1KG
-
2021-07-02
- CAS:38651-65-9
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | (1R)-(+)-NOPINONE Basic information |
| Product Name: | (1R)-(+)-NOPINONE | | Synonyms: | (1R)-(+)-NOPINONE;Nopinon;(1R,5S)-(+)-nopinone;(1R)-(+)-Nopinone 98%;(1R)-(+)-Norinone;6,6-DIMETHYLBICYCLO[3.1.1]HEPTAN-2-ONE;(1R,5S)-6,6-Dimethylbicyclo[3.1.1]heptan-2-one;Bicyclo(3.1.1)heptan-2-one, 6,6-dimethyl-, (1R)- | | CAS: | 38651-65-9 | | MF: | C9H14O | | MW: | 138.21 | | EINECS: | | | Product Categories: | | | Mol File: | 38651-65-9.mol |  |
| | (1R)-(+)-NOPINONE Chemical Properties |
| Melting point | -1°C | | Boiling point | 209 °C (lit.) | | density | 0.981 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.479(lit.) | | Fp | 167 °F | | storage temp. | 2-8°C | | form | liquid | | Optical Rotation | [α]20/D +16°, neat | | InChI | 1S/C9H14O/c1-9(2)6-3-4-8(10)7(9)5-6/h6-7H,3-5H2,1-2H3/t6-,7-/m0/s1 | | InChIKey | XZFDKWMYCUEKSS-BQBZGAKWSA-N | | SMILES | CC1(C)[C@H]2CCC(=O)[C@@H]1C2 | | LogP | 1.650 (est) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HS Code | 2914290090 | | Storage Class | 10 - Combustible liquids |
| | (1R)-(+)-NOPINONE Usage And Synthesis |
| Uses | (1R)-(+)-Nopinone is a reagent used in the preparation of chiral ligands for asymmetric catalysis and transformations. |
| | (1R)-(+)-NOPINONE Preparation Products And Raw materials |
|