- 2,3-Difluoroanisole
-
- $0.00 / 1KG
-
2026-01-05
- CAS:134364-69-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 mt
- 2,3-Difluoroanisole
-
- $10.00 / 1KG
-
2025-05-26
- CAS:134364-69-5
- Min. Order: 1KG
- Purity: 99.%
- Supply Ability: 10 ton
|
| | 2,3-Difluoroanisole Basic information |
| Product Name: | 2,3-Difluoroanisole | | Synonyms: | 2,3-DIFLUOROANISOLE;1,2-DIFLUORO-3-METHOXYBENZENE;BENZENE, 1,2-DIFLUORO-3-METHOXY-;Difluoroanisole1;2,3-Difluoroanisole, 97+%;2,3-two fluorineether;1,2-Difluoro-3-methoxybenzene, 2,3-Difluorophenyl methyl ether;3-Difluoroanisole | | CAS: | 134364-69-5 | | MF: | C7H6F2O | | MW: | 144.12 | | EINECS: | | | Product Categories: | Fluorine series;blocks;FluoroCompounds;Aromatic Halides (substituted);Phenyls & Phenyl-Het;Fluorobenzene;Phenyls & Phenyl-Het | | Mol File: | 134364-69-5.mol |  |
| | 2,3-Difluoroanisole Chemical Properties |
| Boiling point | 144.5±20.0 °C(Predicted) | | density | 1.24 | | refractive index | 1.4710-1.4750 | | Fp | 62°(144°F) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H6F2O/c1-10-6-4-2-3-5(8)7(6)9/h2-4H,1H3 | | InChIKey | RDOGTTNFVLSBKG-UHFFFAOYSA-N | | SMILES | C1(F)=CC=CC(OC)=C1F | | CAS DataBase Reference | 134364-69-5(CAS DataBase Reference) |
| Hazard Codes | F,Xi,Xn | | Risk Statements | 10-36/37/38-22 | | Safety Statements | 16-26-36-37 | | RIDADR | 1993 | | Hazard Note | Flammable | | HazardClass | IRRITANT, FLAMMABLE | | PackingGroup | III | | HS Code | 29093090 |
| Provider | Language |
|
ALFA
| English |
| | 2,3-Difluoroanisole Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | 2,3-Difluoroaniline was used in the synthesis of ethyl 2-arylamino-4-trifluoromethylpyrimidine-5-carboxylate.
| | Synthesis |
2,3-difluoroanisole can be synthesized by the combined action of 2,3-difluorophenol, DMSO, methyl iodide and potassium carbonate.
|
| | 2,3-Difluoroanisole Preparation Products And Raw materials |
|