|
|
| | 5-Trifluoromethoxy-1H-indole Basic information |
| | 5-Trifluoromethoxy-1H-indole Chemical Properties |
| Boiling point | 247.5±35.0 °C(Predicted) | | density | 1.413±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 16.06±0.30(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C9H6F3NO/c10-9(11,12)14-7-1-2-8-6(5-7)3-4-13-8/h1-5,13H | | InChIKey | XVYXWSODSCHHHB-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(OC(F)(F)F)C=C2)C=C1 |
| | 5-Trifluoromethoxy-1H-indole Usage And Synthesis |
| Uses | 5-Trifluoromethoxy-1H-indole is an organic compound that is often used as an intermediate in drug research and chemical synthesis. |
| | 5-Trifluoromethoxy-1H-indole Preparation Products And Raw materials |
|