Related articles - 5,6,7,8-TETRAHYDRO-1-NAPHTHOL
- 5,6,7,8-Tetrahydro-1-naphthol is a useful chemical intermediate, widely applied in organic synthesis and also used as a fuel a....
- Dec 31,2019
|
| Product Name: | 5,6,7,8-TETRAHYDRO-1-NAPHTHOL | | Synonyms: | 5,6,7,8-TETRAHYDRO-1-NAPHTHOL;1-Naphthol, 5,6,7,8-tetrahydro-;5,6,7,8-tetrahydro-1-naphthaleno;5,6,7,8-Tetrahydro-1-naphthalenol;5,6,7,8-Tetrahydro-alpha-naphthol;5,6,7,8-Tetrahydronaphthalenol;5-Hydroxytetralin;Tetrahydro-alpha-naphthol | | CAS: | 529-35-1 | | MF: | C10H12O | | MW: | 148.2 | | EINECS: | 208-461-1 | | Product Categories: | Organic Building Blocks;Oxygen Compounds;Phenols | | Mol File: | 529-35-1.mol |  |
| | 5,6,7,8-TETRAHYDRO-1-NAPHTHOL Chemical Properties |
| Melting point | 69-71 °C(lit.) | | Boiling point | 264-265 °C705 mm Hg(lit.) | | density | 1.0556 | | refractive index | 1.5000 (estimate) | | Fp | 264-265°C/705mm | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | pK1:10.28 (25°C) | | form | Solid | | color | Off-White to Pale Orange | | BRN | 1865081 | | InChI | InChI=1S/C10H12O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h3,5,7,11H,1-2,4,6H2 | | InChIKey | SCWNNOCLLOHZIG-UHFFFAOYSA-N | | SMILES | C1(O)=C2C(CCCC2)=CC=C1 | | CAS DataBase Reference | 529-35-1(CAS DataBase Reference) | | EPA Substance Registry System | 1-Naphthalenol, 5,6,7,8-tetrahydro- (529-35-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29071990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5,6,7,8-TETRAHYDRO-1-NAPHTHOL Usage And Synthesis |
| Uses | 5,6,7,8-Tetrahydro-1-naphthol is a useful chemical intermediate, widely applied in organic synthesis and also used as a fuel additive.
| | Industrial Production | 5,6,7,8-Tetrahydro-1-naphthol can be produced through partial reduction of aromatic ring of 1-naphthol by various homogeneous or heterogeneous catalytic hydrogenation methods.
| | Chemical Properties | white to slightly pink crystalline mass or | | Uses | 5,6,7,8-Tetrahydro-1-naphthalenol was used as a reagent in the synthesis of phosphonamidate and phosphonodiamidate prodrugs of adefovir and tenofovir which are used in the treatment of HIV infections. Also used in the synthesis of tetrahydronaphthalene-1-ol derivatives which were found to be promising potent antitumor agents. | | Definition | ChEBI: 5,6,7,8-tetrahydro-1-naphthol is 1-naphthol hydrogenated at C-5, -6, -7 and -8. |
| | 5,6,7,8-TETRAHYDRO-1-NAPHTHOL Preparation Products And Raw materials |
| Raw materials | Naphthalene, 1,2,3,4-tetrahydro-5-(2,2,2-trifluoroethoxy)--->Methanesulfonic acid, 1,1,1-trifluoro-, 5,6,7,8-tetrahydro-1-naphthalenyl ester-->1-bromotetralin-->1,2,3,4-Tetrahydro-1-naphthol-->1-Naphthol-->1-Tetralone | | Preparation Products | 5,6,7,8-Tetrahydro-2-naphthol-->N-Methylcarbamic acid 5,6,7,8-tetrahydronaphthalen-1-yl ester-->1-(1-HYDROXY-5,6,7,8-TETRAHYDRO-NAPHTHALEN-2-YL)-ETHANONE |
|