|
|
| | 2,2'-BIPYRIDINE-6,6'-DICARBOXYLIC ACID Basic information |
| Product Name: | 2,2'-BIPYRIDINE-6,6'-DICARBOXYLIC ACID | | Synonyms: | 2,2'-BIPYRIDINE-6,6'-DICARBOXYLIC ACID;6,6'-Bipicolinic acid;2,2Bipyridyl-6,6'-dicarboxylic acid;2,2'-bipyridine-6,6'-dicarboxylic acid 97%;6-(6-carboxypyridin-2-yl)pyridine-2-carboxylic acid;2,2'-Bipyridine-6,6'-dicarboxylicAcid>;2,2'-BIPYRIDINE-6,6'-DICARBOXYLIC ACID ISO 9001：2015 REACH;2-BIPYRIDINE-6 | | CAS: | 4479-74-7 | | MF: | C12H8N2O4 | | MW: | 244.2 | | EINECS: | 806-930-0 | | Product Categories: | | | Mol File: | 4479-74-7.mol |  |
| | 2,2'-BIPYRIDINE-6,6'-DICARBOXYLIC ACID Chemical Properties |
| Melting point | 286℃ | | Boiling point | 568.1±50.0 °C(Predicted) | | density | 1.469 | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | powder to crystal | | pka | 2.97±0.10(Predicted) | | color | White to Almost white | | λmax | 288nm(H2O)(lit.) | | InChI | InChI=1S/C12H8N2O4/c15-11(16)9-5-1-3-7(13-9)8-4-2-6-10(14-8)12(17)18/h1-6H,(H,15,16)(H,17,18) | | InChIKey | DASAXWLMIWDYLQ-UHFFFAOYSA-N | | SMILES | C1(C2=NC(C(O)=O)=CC=C2)=NC(C(O)=O)=CC=C1 | | CAS DataBase Reference | 4479-74-7 |
| | 2,2'-BIPYRIDINE-6,6'-DICARBOXYLIC ACID Usage And Synthesis |
| Uses | 2,2′-Bipyridine-6,6′-dicarboxylic acid (BPDC) is an organic heterocyclic compound belonging to the bipyridine family. It consists of two pyridine rings linked by a carbonyl group. BPDC is used in the synthesis of organic compounds, enzyme inhibition studies, development of molecular probes and molecular recognition studies. |
| | 2,2'-BIPYRIDINE-6,6'-DICARBOXYLIC ACID Preparation Products And Raw materials |
|