|
|
| | Ethyl 2-(1-benzhydrylazetidin-3-ylidene) acetate Basic information |
| Product Name: | Ethyl 2-(1-benzhydrylazetidin-3-ylidene) acetate | | Synonyms: | Acetic acid, 2-[1-(diphenylMethyl)-3-azetidinylidene]-, ethyl ester;2-[1-(diphenylmethyl)-3-azetidinylidene]acetic acid ethyl ester;Ethyl 2-(1-benzhydrylazetidin-3-ylidene) acetate - [E6193];Ethyl 2-(1-benzhydrylazetidin-3-ylidene) acetate | | CAS: | 158602-32-5 | | MF: | C20H21NO2 | | MW: | 307.39 | | EINECS: | | | Product Categories: | | | Mol File: | 158602-32-5.mol |  |
| | Ethyl 2-(1-benzhydrylazetidin-3-ylidene) acetate Chemical Properties |
| Boiling point | 415.6±35.0 °C(Predicted) | | density | 1.191±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 5.60±0.20(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C20H21NO2/c1-2-23-19(22)13-16-14-21(15-16)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-13,20H,2,14-15H2,1H3 | | InChIKey | MMUAPMICLHEYFY-UHFFFAOYSA-N | | SMILES | O=C(OCC)C=C1CN(C(C2=CC=CC=C2)C3=CC=CC=C3)C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Ethyl 2-(1-benzhydrylazetidin-3-ylidene) acetate Usage And Synthesis |
| | Ethyl 2-(1-benzhydrylazetidin-3-ylidene) acetate Preparation Products And Raw materials |
|