| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:beta-Nicotinamide adenine dinucleotide 3'-phosphate sodium salt hydrate >=90%
CAS:50443-29-3
Purity:NULL Package:25mg Remarks:NULL
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:β-Nicotinamide adenine dinucleotide 3′-phosphate sodium salt hydrate
|
| Company Name: |
Shanghai meikai technology co., ltd
|
| Tel: |
021-68689288 15300790979 |
| Email: |
info@mkbio.com.cn |
| Products Intro: |
Product Name:Phosphonic acid, P,P′-methylenebis
CAS:50443-29-3
Purity:95%
|
|
| | 3'-NADP SODIUM SALT Basic information |
| Product Name: | 3'-NADP SODIUM SALT | | Synonyms: | 3'-NADP SODIUM SALT;3'-TPN SODIUM SALT;BETA-NICOTINAMIDE ADENINE DINUCLEOTIDE 3'-PHOSPHATE SODIUM SALT;B-nicotinamide adenine dinucleotide*3-phosphate;3'-nadp;β-nicotinamide adenine dinucleotide 3'-phosphate sodium salt hydrate;3′-TPN;beta-Nicotinamide adenine dinucleotide 3'-phosphate sodium salt hydrate >=90% | | CAS: | 50443-29-3 | | MF: | C21H27N7NaO17P3 | | MW: | 765.39 | | EINECS: | 214-664-6 | | Product Categories: | | | Mol File: | 50443-29-3.mol |  |
| | 3'-NADP SODIUM SALT Chemical Properties |
| storage temp. | -20°C | | InChIKey | INEQPRUZJJFDHZ-REWCRBICSA-M | | SMILES | [Na+].[H]O[H].NC(=O)c1ccc[n+](c1)[C@@H]2O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]3O[C@H]([C@@H](O)[C@@H]3OP(O)(O)=O)n4cnc5c(N)ncnc45)[C@@H](O)[C@H]2O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 3'-NADP SODIUM SALT Usage And Synthesis |
| Chemical Properties | White powder, highly hygroscopic, soluble in water and methanol, slightly soluble in ethanol, almost insoluble in ether and ethyl acetate. | | Uses | β-Nicotinamide adenine dinucleotide 3′-phosphate (3′-NADP) is an analogue of NADP+ used to as a substrate and/or inhibitor to study the specificity and kinetics of NADP-dependent oxidoredutase enzymes. |
| | 3'-NADP SODIUM SALT Preparation Products And Raw materials |
|