2-Bromo-4,5-dimethyl-pyridine manufacturers
|
| | 2-Bromo-4,5-dimethyl-pyridine Basic information |
| | 2-Bromo-4,5-dimethyl-pyridine Chemical Properties |
| Boiling point | 252.6±35.0 °C(Predicted) | | density | 1.415±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 1.74±0.18(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H8BrN/c1-5-3-7(8)9-4-6(5)2/h3-4H,1-2H3 | | InChIKey | OTVKPSUMDAFRQC-UHFFFAOYSA-N | | SMILES | C1(Br)=NC=C(C)C(C)=C1 |
| | 2-Bromo-4,5-dimethyl-pyridine Usage And Synthesis |
| Uses | 2-Bromo-4,5-dimethylpyridine is a reagent used in the preparation of tetrahydroindazoles as inhibitors of human dihydroorotate dehydrogenase. |
| | 2-Bromo-4,5-dimethyl-pyridine Preparation Products And Raw materials |
|