2-Methyl-D-phenylalanine manufacturers
|
| | 2-Methyl-D-phenylalanine Basic information |
| | 2-Methyl-D-phenylalanine Chemical Properties |
| Melting point | 277-279 °C(Solv: acetone (67-64-1)) | | Boiling point | 312.8±30.0 °C(Predicted) | | density | 1.166±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Powder | | pka | 2.25±0.10(Predicted) | | color | White to pale yellow | | Optical Rotation | 77.1°(C=0.10g/100mL MeOH) | | BRN | 5254151 | | Major Application | peptide synthesis | | InChI | 1S/C10H13NO2/c1-10(11,9(12)13)7-8-5-3-2-4-6-8/h2-6H,7,11H2,1H3,(H,12,13)/t10-/m1/s1 | | InChIKey | HYOWVAAEQCNGLE-SNVBAGLBSA-N | | SMILES | C[C@@](N)(Cc1ccccc1)C(O)=O | | CAS DataBase Reference | 17350-84-4(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-Methyl-D-phenylalanine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | α-Methyl-D-phenylalanine is used to prepare hippuryl-α-methylphenylalanine and hippuryl-α-methylphenyllactic acid as substrates for carboxypeptidase A. It is also used in the synthesis of high affinity tachykinin NK2 receptor antagonists. | | Uses | 2-Methyl-D-phenylalanine is a derivative of D-Phenylalanine (P319410); the stereoisomer of L-Phenylalanine (P319415) used in the synthesis of Schaeffer’s acid analogs as important structures in tuberculostatic design. These analogs exhibit the ability to inhibit Mycobacterium tuberculosis type II dehydroquinase. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 2-Methyl-D-phenylalanine Preparation Products And Raw materials |
|