|
|
| | (1R,5S,6R)-3-azabicyclo[3.1.0]hexan-6-ylmethanol Basic information |
| Product Name: | (1R,5S,6R)-3-azabicyclo[3.1.0]hexan-6-ylmethanol | | Synonyms: | (1R,5S,6R)-3-azabicyclo[3.1.0]hexan-6-ylmethanol;(1R,5S,6R)-(3-Azabicyclo[3.1.0]hex-6-yl)methanol;(1R,5S,6R)-3-Aza-6-(hydroxymethyl)bicyclo[3.1.0]hexane 95+%;(1R,5S,6R)-(3-Azabicyclo[3.1.0]hex-6-yl)methanol 95+%;(1R,5S,6R)-6-(Hydroxymethyl)-3-azabicyclo[3.1.0]hexane;exo-3-azabicyclo[3.1.0]hexane-6-Methanol;(1R,5S,6s)-3-aza-bicyclo[3.1.0]hexan-6-ylMethanol;exo-3-Azabicyclo[3.1.0]hexan-6-ylmethanol | | CAS: | 134575-13-6 | | MF: | C6H11NO | | MW: | 113.16 | | EINECS: | | | Product Categories: | | | Mol File: | 134575-13-6.mol | ![(1R,5S,6R)-3-azabicyclo[3.1.0]hexan-6-ylmethanol Structure](CAS/GIF/134575-13-6.gif) |
| | (1R,5S,6R)-3-azabicyclo[3.1.0]hexan-6-ylmethanol Chemical Properties |
| Melting point | 98-100 °C | | Boiling point | 202.5±13.0 °C(Predicted) | | density | 1.108±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | solid | | pka | 14.94±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1/C6H11NO/c8-3-6-4-1-7-2-5(4)6/h4-8H,1-3H2/t4-,5+,6+ | | InChIKey | YGYOQZPGFXHQMW-FMCRUOTFNA-N | | SMILES | [C@@]12([H])CNC[C@@]1([C@H]2CO)[H] |&1:0,5,6,r| |
| HS Code | 2914290090 | | Storage Class | 11 - Combustible Solids |
| | (1R,5S,6R)-3-azabicyclo[3.1.0]hexan-6-ylmethanol Usage And Synthesis |
| | (1R,5S,6R)-3-azabicyclo[3.1.0]hexan-6-ylmethanol Preparation Products And Raw materials |
|