(S)-(4-Isopropyloxazolin-2-yl)ferrocene manufacturers
|
| | (S)-(4-Isopropyloxazolin-2-yl)ferrocene Basic information |
| Product Name: | (S)-(4-Isopropyloxazolin-2-yl)ferrocene | | Synonyms: | (S)-(4-Isopropyloxazolin-2-yl)ferrocene;(S)-(-)-[4,5-Dihydro-4-(1-methylethyl)-2-oxazolyl]ferrocene, min. 98%;[(4S)-4,5-dihydro-4-(1-Methylethyl)-2-oxazolyl]-Ferrocene;(S)-(4-Isopropyloxazolin-2-yl)ferrocene;[(4S)-4,5-Dihydro-4-(1-methylethyl)-2-oxazolyl]ferrocene,99%e.e.;(S)-(-)-[4,5-Dihydro-4-(1-methylethyl)-2-oxazolyl]ferrocene;(S)-(4-Isopropyloxazolin-2-yl)ferrocene>(S)-iPr-Ferrox | | CAS: | 162157-03-1 | | MF: | C11H14NO.C5H5.Fe | | MW: | 297.177 | | EINECS: | | | Product Categories: | | | Mol File: | 162157-03-1.mol |  |
| | (S)-(4-Isopropyloxazolin-2-yl)ferrocene Chemical Properties |
| alpha | -135° (c 1.0, Ethanol) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | color | orange | | InChI | InChI=1/C11H14NO.C5H5.Fe/c1-8(2)10-7-13-11(12-10)9-5-3-4-6-9;1-2-4-5-3-1;/h3-6,8,10H,7H2,1-2H3;1-5H;/t10-;;/s3 | | InChIKey | IRQUXGJAMKFZTN-WTVPDBJGNA-N | | SMILES | [CH]1[CH][CH][CH][CH]1.C1[C@H](C(C)C)N=C([C]2[CH][CH][CH][CH]2)O1.[Fe] |&1:6,r,^1:0,1,2,3,4,12,13,14,15,16| | | CAS DataBase Reference | 162157-03-1 |
| | (S)-(4-Isopropyloxazolin-2-yl)ferrocene Usage And Synthesis |
| | (S)-(4-Isopropyloxazolin-2-yl)ferrocene Preparation Products And Raw materials |
|