|
|
| | 2-[N,N-BIS(TRIFLUOROMETHANESULFONYL)AMINO]-5-CHLOROPYRIDINE Basic information |
| Product Name: | 2-[N,N-BIS(TRIFLUOROMETHANESULFONYL)AMINO]-5-CHLOROPYRIDINE | | Synonyms: | Comins Reagent, N,N-Bis(trifluoromethylsulfonyl)-5-chloro-2-pyridylamine, 2-[N,N-Bis(trifluoromethylsulfonyl)amino]-5-chloropyridine;N-(5-CHLORO-2-PYRIDYL)BIS(TRILFUOROMETHANESULFONIMIDE);N-(5-Chloropyridin-2-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;2-[N,N-Bis(trifluoromethanesulfonyl)amino]-5-chloropyridine ,98%;Comins Triflating Reagent;N-(5-Chloro-2-pyridyl)triflimide
N-(5-Chloro-2-pyridyl)bis(trifluoromethanesulfonyl)imide
Comins Triflating Reagent;N-(5-chloropyridin-2-yl)-1,1,1-trifluoro-N-(trifluoroMethane)sulfonylMethanesulfonaMide;2-{Bis[(trifluoromethyl)sulphonyl]amino}-5-chloropyridine | | CAS: | 145100-51-2 | | MF: | C7H3ClF6N2O4S2 | | MW: | 392.68 | | EINECS: | 629-110-2 | | Product Categories: | Chloropyridines;Halopyridines | | Mol File: | 145100-51-2.mol | ![2-[N,N-BIS(TRIFLUOROMETHANESULFONYL)AMINO]-5-CHLOROPYRIDINE Structure](CAS/GIF/145100-51-2.gif) |
| | 2-[N,N-BIS(TRIFLUOROMETHANESULFONYL)AMINO]-5-CHLOROPYRIDINE Chemical Properties |
| Melting point | 45-47 °C(lit.) | | Boiling point | 77-90°C/0.2mmHg | | density | 1.892±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Benzene (Slightly) | | form | Solid | | pka | -7.71±0.10(Predicted) | | color | yellow | | Water Solubility | Reacts with water. | | Sensitive | Moisture Sensitive | | BRN | 5833971 | | Stability: | Moisture Sensitive, Unstable in DMSO Solution | | InChI | InChI=1S/C7H3ClF6N2O4S2/c8-4-1-2-5(15-3-4)16(21(17,18)6(9,10)11)22(19,20)7(12,13)14/h1-3H | | InChIKey | TUFGVZMNGTYAQD-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)S(N(C1=NC=C(Cl)C=C1)S(C(F)(F)F)(=O)=O)(=O)=O | | CAS DataBase Reference | 145100-51-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 9 | | Hazard Note | Irritant | | HazardClass | AIR SENSITIVE, IRRITANT-HARMFUL, KEEP COLD | | HS Code | 29350090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-[N,N-BIS(TRIFLUOROMETHANESULFONYL)AMINO]-5-CHLOROPYRIDINE Usage And Synthesis |
| Chemical Properties | White to pale yellow crystalline solid | | Uses | 2-[N,N-Bis(trifluoromethylsulfonyl)amino]-5-chloropyridine provides good yields of vinyl triflates from the corresponding ketone enolates or dienolates. It is used in the total synthesis of (-)-porantheridine and the trans decahydroquinoline alkaloid (+)-219A. It is also used as a reactant for Suzuki-Miyaura cross coupling, synthesis of nicotinic acetylcholine receptor-selective ligands, enantioselective desymmetrizing palladium catalyzed carbonylation reactions, synthesis of high affinity niacin receptor GPR109A agonists and in preparation of heteroaromatics. | | Uses | Reactant for: Suzuki-Miyaura cross coupling Synthesis of nicotinic acetylcholine receptor-selective ligands Enantioselective desymmetrizing palladium catalyzed carbonylation reactions Synthesis of high affinity niacin receptor GPR109A agonists Preparation of heteroaromatics |
| | 2-[N,N-BIS(TRIFLUOROMETHANESULFONYL)AMINO]-5-CHLOROPYRIDINE Preparation Products And Raw materials |
|