|
|
| | Iron(III) trifluoromethanesulfonate Basic information |
| Product Name: | Iron(III) trifluoromethanesulfonate | | Synonyms: | Iron(III) trifluoromethanesulfonate;Iron 1,1,1-trifluoro-methanesulfonic acid;Iron(III) triflate;Iron(III) trifluoromethanesulfonate 90%;Iron(Ⅲ)trifluoroMethanesulfonate;Fe(CF3SO3)3;Fe(OTf)3;Ferric triflate | | CAS: | 63295-48-7 | | MF: | CHF3FeO3S | | MW: | 205.92 | | EINECS: | | | Product Categories: | triflate | | Mol File: | 63295-48-7.mol |  |
| | Iron(III) trifluoromethanesulfonate Chemical Properties |
| Melting point | 183 °C | | Fp | 110°(230°F) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder | | Water Solubility | Soluble in water, methanol and acetonitrile. | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/CHF3O3S.Fe/c2-1(3,4)8(5,6)7;/h(H,5,6,7); | | InChIKey | QZLVALRWETVYSE-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)S(O)(=O)=O.[Fe] | | CAS DataBase Reference | 63295-48-7 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 |
| | Iron(III) trifluoromethanesulfonate Usage And Synthesis |
| Uses | Iron(III) triflate is used as an efficient catalyst in the synthesis of 2,3-unsaturated-O-glycosides from 2,4,6-tri-O-acetyl-D-glucal. It is also involved in the synthesis of a variety of beta-enamino ketones and esters. | | General Description | This product has been enhanced for catalytic efficiency. | | reaction suitability | core: iron
reagent type: catalyst |
| | Iron(III) trifluoromethanesulfonate Preparation Products And Raw materials |
|