| Company Name: |
Hangzhou Sage Chemical Co., Ltd.
|
| Tel: |
+86057186818502 13588463833 |
| Email: |
info@sagechem.com |
| Products Intro: |
Product Name:Piperidine, 1-benzoyl-3-(3,4-dichlorophenyl)-3-(3-iodopropyl)-, (3S)- CAS:188916-67-8 Purity:98% Package:1g;5g;100g;Bulk
|
| Company Name: |
Nanjing JinruiJiuAn Biotechnology Co., Ltd.
|
| Tel: |
025-58196018 800028039 |
| Email: |
sales@fartop.net |
| Products Intro: |
Product Name:Methanone, [(3S)-3-(3,4-dichlorophenyl)-3-(3-iodopropyl)-1-piperidinyl]phenyl- CAS:188916-67-8 Purity:97%
|
| Company Name: |
Alfa Chemistry
|
| Tel: |
+1 (201) 478-8534 |
| Email: |
info@Alfa-Chemistry.com |
| Products Intro: |
|
|
| | (S)-(3-(3,4-dichlorophenyl)-3-(3-iodopropyl)piperidin-1-yl)(phenyl)methanone Basic information |
| Product Name: | (S)-(3-(3,4-dichlorophenyl)-3-(3-iodopropyl)piperidin-1-yl)(phenyl)methanone | | Synonyms: | (S)-(3-(3,4-dichlorophenyl)-3-(3-iodopropyl)piperidin-1-yl)(phenyl)methanone;Methanone, [(3S)-3-(3,4-dichlorophenyl)-3-(3-iodopropyl)-1-piperidinyl]phenyl-;Piperidine, 1-benzoyl-3-(3,4-dichlorophenyl)-3-(3-iodopropyl)-, (3S)-;[(3S)-3-(3,4-dichlorophenyl)-3-(3-iodopropyl)piperidin-1-yl]-phenylmethanone;[(3S)-3-(3,4-Dichlorophenyl)-3-(3-iodopropyl)-1-piperidinyl]phenylmethanone | | CAS: | 188916-67-8 | | MF: | C21H22Cl2INO | | MW: | 502.22 | | EINECS: | | | Product Categories: | | | Mol File: | 188916-67-8.mol |  |
| | (S)-(3-(3,4-dichlorophenyl)-3-(3-iodopropyl)piperidin-1-yl)(phenyl)methanone Chemical Properties |
| Boiling point | 566.2±50.0 °C(Predicted) | | density | 1.503 | | pka | -2.05±0.40(Predicted) | | InChI | InChI=1S/C21H22Cl2INO/c22-18-9-8-17(14-19(18)23)21(10-4-12-24)11-5-13-25(15-21)20(26)16-6-2-1-3-7-16/h1-3,6-9,14H,4-5,10-13,15H2/t21-/m0/s1 | | InChIKey | XFAAEZSRGNMTTA-NRFANRHFSA-N | | SMILES | C(N1CCC[C@@](C2=CC=C(Cl)C(Cl)=C2)(CCCI)C1)(C1=CC=CC=C1)=O |
| | (S)-(3-(3,4-dichlorophenyl)-3-(3-iodopropyl)piperidin-1-yl)(phenyl)methanone Usage And Synthesis |
| Uses | (S)-(3-(3,4-dichlorophenyl)-3-(3-iodopropyl)piperidin-1-yl)(phenyl)methanone can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly for laboratory research and development process and chemical production process. |
| | (S)-(3-(3,4-dichlorophenyl)-3-(3-iodopropyl)piperidin-1-yl)(phenyl)methanone Preparation Products And Raw materials |
|