| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Tubulin Polymerization Inhibitor II Basic information |
| | Tubulin Polymerization Inhibitor II Chemical Properties |
| Boiling point | 549.5±50.0 °C(Predicted) | | density | 1.241±0.06 g/cm3(Predicted) | | storage temp. | +2C to +8C | | solubility | DMSO: 10mg/mL | | form | Yellow solid | | pka | 12.16±0.20(Predicted) | | color | yellow | | InChI | 1S/C19H19NO5/c1-22-12-5-6-13-14(19(21)20-15(13)10-12)7-11-8-16(23-2)18(25-4)17(9-11)24-3/h5-10H,1-4H3,(H,20,21) | | InChIKey | YLUHXAHNPQALMQ-UHFFFAOYSA-N | | SMILES | N1c2c(ccc(c2)OC)C(=Cc3cc(c(c(c3)OC)OC)OC)C1=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Tubulin Polymerization Inhibitor II Usage And Synthesis |
| Uses | Tubulin Polymerization Inhibitor II is a Tubulin inhibitor. | | General Description | A cell-permeable, SU5416- (Cat. Nos. 676487 and 676498) derived combretastatin A-4 (Cat. No. 234200) analog that acts as an effective anti-microtubule agent (IC50 = 4.5 μM in inhibiting polymerization of purified porcine brain tubulin) and displays extremely potent anti-proliferative activity towards various cancer cell lines (GI50<10 nM for 46 lines among a 53 NCI panel tested). | | Biochem/physiol Actions | Cell permeable: yes |
| | Tubulin Polymerization Inhibitor II Preparation Products And Raw materials |
|