|
|
| | 4-(2-Oxiranylmethoxy)benzoic Acid Methyl Ester Basic information |
| | 4-(2-Oxiranylmethoxy)benzoic Acid Methyl Ester Chemical Properties |
| solubility | Chloroform, Dichloromethane, Ethyl Acetate | | form | Solid | | color | White | | InChI | InChI=1S/C11H12O4/c1-13-11(12)8-2-4-9(5-3-8)14-6-10-7-15-10/h2-5,10H,6-7H2,1H3 | | InChIKey | GVMPCQYYYYFGMV-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(OCC2CO2)C=C1 |
| | 4-(2-Oxiranylmethoxy)benzoic Acid Methyl Ester Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 4-(2-Oxiranylmethoxy)benzoic Acid Methyl Ester is a intermediate in the production of tyrosinase-inhibitors used in skin lightening cosmetics. |
| | 4-(2-Oxiranylmethoxy)benzoic Acid Methyl Ester Preparation Products And Raw materials |
|