| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- TPP-p-NH2-PH2
-
- $1.00
-
2019-07-06
- CAS:67605-64-5
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100KG
|
| | 4-(10,15,20-Triphenyl-21H,23H-porphin-5-yl)benzenamine Basic information | | Uses |
| Product Name: | 4-(10,15,20-Triphenyl-21H,23H-porphin-5-yl)benzenamine | | Synonyms: | 4-(10,15,20-Triphenyl-21H,23H-porphin-5-yl)benzenamine;4-(10,15,20-Triphenylporphyrin-5-yl)phenylamine;5-(4-Aminophenyl)-10,15,20-triphenyl-21H,23H-porphine;5-(4-aMinophenyl)-10,15,20-triphenyl porphine;4-(10,14-(10,15,20-triphenyl-21H,23H-porphin-5-yl)-Benzenamine;4-[(1Z,4Z,9Z,15Z)-10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl]aniline;TPP-p-NH2-PH2;5-(4-Aminophenyl)-10,15,20-tris(phenyl)porphyrin | | CAS: | 67605-64-5 | | MF: | C44H31N5 | | MW: | 629.75 | | EINECS: | | | Product Categories: | | | Mol File: | 67605-64-5.mol |  |
| | 4-(10,15,20-Triphenyl-21H,23H-porphin-5-yl)benzenamine Chemical Properties |
| density | 1.278 | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | Appearance | Pale purple to purple Solid | | InChIKey | NSCOPASYOISSAC-LWQDQPMZSA-N | | SMILES | C1(N)=CC=C(C2=C3N=C(C(C4=CC=CC=C4)=C4NC(=C(C5=CC=CC=C5)C5=NC(=C(C6=CC=CC=C6)C6NC2=CC=6)C=C5)C=C4)C=C3)C=C1 |c:16,t:5,19,30| |
| | 4-(10,15,20-Triphenyl-21H,23H-porphin-5-yl)benzenamine Usage And Synthesis |
| Uses | 4-(10,15,20-triphenylporphyrin-5-yl)aniline is an amine organic compound that can be used as an intermediate in organic synthesis. |
| | 4-(10,15,20-Triphenyl-21H,23H-porphin-5-yl)benzenamine Preparation Products And Raw materials |
|