9-Decenoic acid, methyl ester manufacturers
|
| | 9-Decenoic acid, methyl ester Basic information |
| Product Name: | 9-Decenoic acid, methyl ester | | Synonyms: | 9-Decenoic acid, methyl ester;methyl Sdecenoate;9-Decenoic acid, methyl;methyl dec-9-enoate;Methyl dec-9-enoate,98% (stabilized with MEHQ);Methyl 9-Decenoate;Methyl dec-9-enoate (Stabilized with MEHQ) - [M70344] | | CAS: | 25601-41-6 | | MF: | C11H20O2 | | MW: | 184.28 | | EINECS: | 662-772-0 | | Product Categories: | | | Mol File: | 25601-41-6.mol |  |
| | 9-Decenoic acid, methyl ester Chemical Properties |
| Boiling point | 123 °C(Press: 21 Torr) | | density | 0.883±0.06 g/cm3(Predicted) | | vapor pressure | 13.37Pa at 25℃ | | storage temp. | 2-8°C, stored under nitrogen | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C11H20O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3H,1,4-10H2,2H3 | | InChIKey | SBIGSHCJXYGFMX-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCCCCCCC=C | | LogP | 4.6 at pH7.8 | | Surface tension | 70.8mN/m at 7.8mg/L and 22℃ | | EPA Substance Registry System | 9-Decenoic acid, methyl ester (25601-41-6) |
| | 9-Decenoic acid, methyl ester Usage And Synthesis |
| Uses | 9-Decenoic acid, methyl ester is on the EPA's list of safer chemicals that have been verified as low concern and are commonly used as organic solvents. |
| | 9-Decenoic acid, methyl ester Preparation Products And Raw materials |
|