Tetramethylammonium nitrate manufacturers
- Tetramethylammonium nitrate
-
- $15.00 / 1KG
-
2021-08-12
- CAS:1941-24-8
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | Tetramethylammonium nitrate Basic information |
| | Tetramethylammonium nitrate Chemical Properties |
| Melting point | ≥300 °C(lit.) | | Boiling point | 250.42°C (rough estimate) | | density | 1.2844 (rough estimate) | | refractive index | 1.4800 (estimate) | | storage temp. | 2-8°C, sealed storage, away from moisture | | solubility | H2O: 0.1 g/mL, clear, colorless | | form | Crystalline | | Appearance | White to off-white Solid | | Water Solubility | Soluble in water. | | BRN | 3917260 | | Stability: | Stable. Reacts with rust, bases, copper, strong oxidizing agents, reducing agents. | | InChI | 1S/C4H12N.NO3/c1-5(2,3)4;2-1(3)4/h1-4H3;/q+1;-1 | | InChIKey | QGPVYHSXZFOSRL-UHFFFAOYSA-N | | SMILES | [O-][N+]([O-])=O.C[N+](C)(C)C | | CAS DataBase Reference | 1941-24-8(CAS DataBase Reference) | | EPA Substance Registry System | Methanaminium, N,N,N-trimethyl-, nitrate (1941-24-8) |
| Hazard Codes | O,Xi | | Risk Statements | 8-36/37/38 | | Safety Statements | 17-26-36 | | RIDADR | UN 1479 5.1/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 5.1 | | PackingGroup | III | | HS Code | 29239000 | | Storage Class | 5.1B - Oxidizing hazardous materials | | Hazard Classifications | Eye Irrit. 2
Ox. Sol. 2
Skin Irrit. 2
STOT SE 3 |
| | Tetramethylammonium nitrate Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | Tetramethylammonium Nitrate can be used as a glycolate oxidase inhibitors. | | Purification Methods | Recrystallise the nitrate from EtOH and dry at 110o in an air oven. [Coats & Taylor J Chem Soc 1498 1936, Beilstein 4 III 113, 4 IV 147.] |
| | Tetramethylammonium nitrate Preparation Products And Raw materials |
|