6-bromo-3-hydroxypyrazine-2-carboxamide manufacturers
|
| | 6-bromo-3-hydroxypyrazine-2-carboxamide Basic information | | Uses |
| Product Name: | 6-bromo-3-hydroxypyrazine-2-carboxamide | | Synonyms: | 6-Bromo-3-hydroxypyrazine-2-carboxamide
6-Bromo-3,4-dihydro-3-oxopyrazinecarboxamide;6-bromo-3-hydroxypyrazine-2-carboxamide;2-PyrazinecarboxaMide, 6-broMo-3,4-dihydro-3-oxo-;6-Bromo-3,4-dihydro-3-oxopyrazinecarboxamide;6-bromo-3-hydroxypyrazine-2-formamide;6-Bromo-3-oxo-3,4-dihydro-pyrazine-2-carboxylic acid amide;5-bromo-2-oxo-1H-pyrazine-3-carboxamide;6-Bromo-3-Hydroxypyrazine-2-Caroboxamide | | CAS: | 259793-88-9 | | MF: | C5H4BrN3O2 | | MW: | 218.01 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 259793-88-9.mol |  |
| | 6-bromo-3-hydroxypyrazine-2-carboxamide Chemical Properties |
| Melting point | 190 - 193°C | | density | 2.23±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 9.02±0.60(Predicted) | | color | Yellow | | InChI | InChI=1S/C5H4BrN3O2/c6-2-1-8-5(11)3(9-2)4(7)10/h1H,(H2,7,10)(H,8,11) | | InChIKey | KZBREXQQUFIWKD-UHFFFAOYSA-N | | SMILES | C1(C(N)=O)=NC(Br)=CNC1=O | | CAS DataBase Reference | 259793-88-9 |
| | 6-bromo-3-hydroxypyrazine-2-carboxamide Usage And Synthesis |
| Uses | 6-Bromo-3-hydroxypyrazine-2-carboxamide is a building block related to Favipiravir(F103350). Favipiravir is used for the treatment of advanced Ebola virus infection in a small animal model. Favipiravir suppressed the replication of Zaire Ebola virus and prevented a lethal outcome in 100% of the animals. Based on the studies, Favipiravir can be a candidate for the treatment of Ebola hemorrhagic fever. | | Uses | 6-Bromo-3-hydroxypyrazine-2-carboxamide is a building block related to Favipiravir(F103350). Favipiravir is used for the treatment of advanced Ebola virus infection in a small animal model. Favipiravir suppressed the replication of Zaire Ebola virus and prevented a lethal outcome in 100% of the animals. Based on the studies, Favipiravir can be a candidate for the treatment of Ebola hemorrhagic fever. |
| | 6-bromo-3-hydroxypyrazine-2-carboxamide Preparation Products And Raw materials |
|