|
|
| | H-Aib-OBzl Basic information |
| Product Name: | H-Aib-OBzl | | Synonyms: | 2-AMino-2-Methylpropanoic acid benzyl ester;H-Aib-OBzl;2-AMino-2-Methylpropanoic acid benzyl;alpha-Aminoisobutyric acid benzyl ester;Alanine, 2-methyl-, phenylmethyl ester;2-Aminoisobutyric acid benzyl ester;2-Aib-Obzl;benzyl 2-amino-2-methylpropanoate hydrochloride | | CAS: | 55456-40-1 | | MF: | C11H15NO2 | | MW: | 193.24 | | EINECS: | | | Product Categories: | | | Mol File: | 55456-40-1.mol |  |
| | H-Aib-OBzl Chemical Properties |
| Boiling point | 131-131.5℃ (18 Torr) | | density | 1.079±0.06 g/cm3(Predicted) | | pka | 7.93±0.25(Predicted) | | InChI | InChI=1S/C11H15NO2/c1-11(2,12)10(13)14-8-9-6-4-3-5-7-9/h3-7H,8,12H2,1-2H3 | | InChIKey | DPEATBWCWKCPRX-UHFFFAOYSA-N | | SMILES | C(OCC1=CC=CC=C1)(=O)[C@](C)(C)N |
| | H-Aib-OBzl Usage And Synthesis |
| | H-Aib-OBzl Preparation Products And Raw materials |
|