3-Aminomethyl-3-[bis(phenylmethyl)amino]oxetane manufacturers
|
| | 3-Aminomethyl-3-[bis(phenylmethyl)amino]oxetane Basic information |
| Product Name: | 3-Aminomethyl-3-[bis(phenylmethyl)amino]oxetane | | Synonyms: | 3-Aminomethyl-3-[bis(phen...;3-AMinoMethyl-3-[bis(phenylMethyl)aMino]oxetane;3-AMinoMethyl-3-[bis(benzyl)aMino]oxetane;3-OxetaneMethanaMine, 3-[bis(phenylMethyl)aMino]-;N,N-dibenzyloxetane-3,3-diaMine;3-Aminomethyl-3-[bis(phenylmethyl)amino]oxetane - [A0680] | | CAS: | 1021392-84-6 | | MF: | C18H22N2O | | MW: | 282.38 | | EINECS: | | | Product Categories: | | | Mol File: | 1021392-84-6.mol | ![3-Aminomethyl-3-[bis(phenylmethyl)amino]oxetane Structure](CAS/GIF/1021392-84-6.gif) |
| | 3-Aminomethyl-3-[bis(phenylmethyl)amino]oxetane Chemical Properties |
| Boiling point | 409.9±40.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 9.65±0.29(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C18H22N2O/c19-13-18(14-21-15-18)20(11-16-7-3-1-4-8-16)12-17-9-5-2-6-10-17/h1-10H,11-15,19H2 | | InChIKey | ZPSXXTVNJOLCNF-UHFFFAOYSA-N | | SMILES | O1CC(N(CC2=CC=CC=C2)CC2=CC=CC=C2)(CN)C1 | | CAS DataBase Reference | 1021392-84-6 |
| | 3-Aminomethyl-3-[bis(phenylmethyl)amino]oxetane Usage And Synthesis |
| Uses | 3-Aminomethyl-3-[bis(phenylmethyl)amino]oxetane is used as a reactant in the preparation of spiropyrido[1,2-a]pyrazine compounds useful as HIV integrase inhibitors for treatment or prevention of HIV infection and AIDS. |
| | 3-Aminomethyl-3-[bis(phenylmethyl)amino]oxetane Preparation Products And Raw materials |
|