|
|
| | Di-t-butyl(3-sulfonatopropyl)phosphine, min. 98% Basic information |
| Product Name: | Di-t-butyl(3-sulfonatopropyl)phosphine, min. 98% | | Synonyms: | Di-t-butyl(3-sulfonatopropyl)phosphineDi-t-butyl(3-sulfonatopropyl)phosphine;3-[Bis(1,1-dimethylethyl)phosphino]-1-propanesulfonic acid;Di-t-butyl(3-sulfonatopropyl)phosphine;3-(Di-t-butylphosphonium)propane sulfonate;Di-t-butyl(3-sulfonatopropyl)phosphine, min. 98%;3-(Di-tert-butylphosphino)propane-1-sulfonic acid, 97%;3-(Di-tert-butylphosphoniuM)propane sulfonate;3-(Di-t-butylphosphoniuM)propane sulfonate, 97% (DTBPPS) | | CAS: | 1055888-89-5 | | MF: | C11H25O3PS | | MW: | 268.35 | | EINECS: | | | Product Categories: | Achiral Phosphine;Alkyl Phosphine | | Mol File: | 1055888-89-5.mol |  |
| | Di-t-butyl(3-sulfonatopropyl)phosphine, min. 98% Chemical Properties |
| Melting point | 132 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 1.79±0.50(Predicted) | | form | solid | | color | white | | Water Solubility | Slightly soluble in water. | | Sensitive | Air & Moisture Sensitive | | InChI | InChI=1S/C11H25O3PS/c1-10(2,3)15(11(4,5)6)8-7-9-16(12,13)14/h7-9H2,1-6H3,(H,12,13,14) | | InChIKey | JPNPRWMRUCIEMN-UHFFFAOYSA-N | | SMILES | C(S(O)(=O)=O)CCP(C(C)(C)C)C(C)(C)C | | CAS DataBase Reference | 1055888-89-5 |
| Risk Statements | 36/37/38 | | Safety Statements | 26-37 | | WGK Germany | WGK 3 | | TSCA | No | | Storage Class | 11 - Combustible Solids |
| | Di-t-butyl(3-sulfonatopropyl)phosphine, min. 98% Usage And Synthesis |
| Uses | Air stable, water soluble phosphine ligand used in palladium catalyzed cross-coupling reactions | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | Di-t-butyl(3-sulfonatopropyl)phosphine, min. 98% Preparation Products And Raw materials |
|