|
|
| | 5-Bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid Basic information |
| | 5-Bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid Chemical Properties |
| density | 1.946±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 3.83±0.30(Predicted) | | form | solid | | Appearance | Off-white to light yellow Solid | | InChI | 1S/C8H5BrN2O2/c9-5-1-4-2-6(8(12)13)11-7(4)10-3-5/h1-3H,(H,10,11)(H,12,13) | | InChIKey | WVRNTDOWZRUIKE-UHFFFAOYSA-N | | SMILES | OC(=O)c1cc2cc(Br)cnc2[nH]1 | | CAS DataBase Reference | 1222175-20-3 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 5-Bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid Usage And Synthesis |
| | 5-Bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid Preparation Products And Raw materials |
|