- 2,4-Dimethoxy-1-nitrobenzene
-
- $15.00 / 1KG
-
2021-08-12
- CAS:4920-84-7
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 2,4-Dimethoxy-1-nitrobenzene Basic information |
| | 2,4-Dimethoxy-1-nitrobenzene Chemical Properties |
| Melting point | 72-76 °C(lit.) | | Boiling point | 256.82°C (rough estimate) | | density | 1.1876 | | refractive index | 1.5310 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | color | Light orange to Yellow to Green | | InChI | InChI=1S/C8H9NO4/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3 | | InChIKey | XXWIYOBCHKCWNT-UHFFFAOYSA-N | | SMILES | C1([N+]([O-])=O)=CC=C(OC)C=C1OC | | CAS DataBase Reference | 4920-84-7(CAS DataBase Reference) |
| Safety Statements | 24/25-22 | | WGK Germany | 3 | | Hazard Note | Harmful | | HS Code | 29093090 |
| | 2,4-Dimethoxy-1-nitrobenzene Usage And Synthesis |
| | 2,4-Dimethoxy-1-nitrobenzene Preparation Products And Raw materials |
|