|
|
| | 1-(2,3-dichlorophenyl)-4-(4-hydroxybutyl)piperazine Basic information |
| | 1-(2,3-dichlorophenyl)-4-(4-hydroxybutyl)piperazine Chemical Properties |
| Boiling point | 442.8±45.0 °C(Predicted) | | density | 1.238±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | 15.16±0.10(Predicted) | | InChI | InChI=1S/C14H20Cl2N2O/c15-12-4-3-5-13(14(12)16)18-9-7-17(8-10-18)6-1-2-11-19/h3-5,19H,1-2,6-11H2 | | InChIKey | TWCMWDBARFJWIY-UHFFFAOYSA-N | | SMILES | N1(CCCCO)CCN(C2=CC=CC(Cl)=C2Cl)CC1 | | CAS DataBase Reference | 870765-38-1 |
| | 1-(2,3-dichlorophenyl)-4-(4-hydroxybutyl)piperazine Usage And Synthesis |
| Uses | 1-(2,3-Dichlorophenyl)-4-(4-hydroxybutyl)piperazine is an intermediate in the synthesis of Aripiprazole (A771000). |
| | 1-(2,3-dichlorophenyl)-4-(4-hydroxybutyl)piperazine Preparation Products And Raw materials |
|