| Company Name: |
Nanjing Easichem Co. ltd. Gold
|
| Tel: |
18061688856 |
| Email: |
easichem@126.com |
| Products Intro: |
Product Name:2-AMino-cyclohex-1-enecarbonitrile
CAS:15595-71-8
Purity:98% Package:5g,25g,100g
|
| Company Name: |
SuZhou ShiYa Biopharmaceuticals, Inc.
|
| Tel: |
86(512)5235 8471 17715136450 |
| Email: |
sales@shiyabiopharm.com |
| Products Intro: |
Product Name:2-AMino-cyclohex-1-enecarbonitrile
CAS:15595-71-8
Purity:95% Package:1 g;5 g;10 g Remarks:S1-1188
|
|
| | 2-AMino-cyclohex-1-enecarbonitrile Basic information |
| | 2-AMino-cyclohex-1-enecarbonitrile Chemical Properties |
| Melting point | 94-95 °C | | Boiling point | 326.9±42.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 6.72±0.20(Predicted) | | Appearance | Light yellow to light brown Solid | | InChI | InChI=1S/C7H10N2/c8-5-6-3-1-2-4-7(6)9/h1-4,9H2 | | InChIKey | PFIVIEDNXASHEY-UHFFFAOYSA-N | | SMILES | C1(C#N)CCCCC=1N |
| | 2-AMino-cyclohex-1-enecarbonitrile Usage And Synthesis |
| | 2-AMino-cyclohex-1-enecarbonitrile Preparation Products And Raw materials |
|