11-(bromomethyl)tricosane manufacturers
|
| | 11-(bromomethyl)tricosane Basic information |
| Product Name: | 11-(bromomethyl)tricosane | | Synonyms: | 11-(bromomethyl)tricosane;2-decyl-1-tetradecyl bromide;1-(bromomethyl)-tricosane;C1014Br;Tricosane, 11-(bromomethyl)-;2-Decyltetradecyl bromide;EA515;11-(Bromomethyl)tricosane - [B94799] | | CAS: | 732276-63-0 | | MF: | C24H49Br | | MW: | 417.55 | | EINECS: | 200-258-5 | | Product Categories: | OPV,OLED | | Mol File: | 732276-63-0.mol |  |
| | 11-(bromomethyl)tricosane Chemical Properties |
| Boiling point | 459.2±13.0 °C(Predicted) | | density | 0.952±0.06 g/cm3(Predicted) | | refractive index | 1.47 | | storage temp. | Store at room temperature | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C24H49Br/c1-3-5-7-9-11-13-14-16-18-20-22-24(23-25)21-19-17-15-12-10-8-6-4-2/h24H,3-23H2,1-2H3 | | InChIKey | JVAQVYKSURQMBE-UHFFFAOYSA-N | | SMILES | CCCCCCCCCCC(CBr)CCCCCCCCCCCC |
| | 11-(bromomethyl)tricosane Usage And Synthesis |
| | 11-(bromomethyl)tricosane Preparation Products And Raw materials |
|