| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | 4-Keto Ibutilide Basic information |
| | 4-Keto Ibutilide Chemical Properties |
| Major Application | pharmaceutical (small molecule) pharmaceutical | | InChI | 1S/C20H34N2O4S/c1-4-6-7-8-9-16-22(5-2)20(24)15-14-19(23)17-10-12-18(13-11-17)21-27(3,25)26/h10-13,19,21,23H,4-9,14-16H2,1-3H3 | | InChIKey | AJYZQCZASWLBGI-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(Nc1ccc(cc1)C(O)CCC(=O)N(CCCCCCC)CC)C |
| WGK Germany | WGK 3 | | HS Code | 2935909550 | | Storage Class | 11 - Combustible Solids |
| | 4-Keto Ibutilide Usage And Synthesis |
| Uses | An intermediate for preparing optically pure Ibutilide fumarate (I155400). |
| | 4-Keto Ibutilide Preparation Products And Raw materials |
|