| Company Name: |
Nanjing Ally Chemical S&T Co., Ltd. Gold
|
| Tel: |
025-025-58367986 18913956109 |
| Email: |
amy.xiang@ally-chem.com |
| Products Intro: |
Product Name:(2R,3R)-1,4-bis(benzyloxy)-2,3-epoxy butane
CAS:80183-15-9
Purity:HPLC98%+
|
|
| | (2R,3R)-2,3-bis(benzyloxyMethyl)oxirane Basic information |
| Product Name: | (2R,3R)-2,3-bis(benzyloxyMethyl)oxirane | | Synonyms: | (2R,3R)-2,3-bis(benzyloxyMethyl)oxirane;(2R,3R)-2,3-Bis[(phenylmethoxy)methyl]-oxirane;Oxirane, 2,3-bis[(phenylmethoxy)methyl]-, (2R-trans)-;(2R,3R)-1,4-bis(benzyloxy)-2,3-epoxy butane;Oxirane, 2,3-bis[(phenylmethoxy)methyl]-, (2R,3R)- | | CAS: | 80183-15-9 | | MF: | C18H20O3 | | MW: | 284.35 | | EINECS: | | | Product Categories: | | | Mol File: | 80183-15-9.mol |  |
| | (2R,3R)-2,3-bis(benzyloxyMethyl)oxirane Chemical Properties |
| Boiling point | 414.4±30.0 °C(Predicted) | | density | 1.121±0.06 g/cm3 (20 ºC 760 Torr) | | InChI | InChI=1S/C18H20O3/c1-3-7-15(8-4-1)11-19-13-17-18(21-17)14-20-12-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2/t17-,18-/m1/s1 | | InChIKey | BWXXSADMQUTHRY-QZTJIDSGSA-N | | SMILES | O1[C@H](COCC2=CC=CC=C2)[C@H]1COCC1=CC=CC=C1 |
| | (2R,3R)-2,3-bis(benzyloxyMethyl)oxirane Usage And Synthesis |
| | (2R,3R)-2,3-bis(benzyloxyMethyl)oxirane Preparation Products And Raw materials |
|