| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Succinylmonocholine chloride
CAS:5297-17-6
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Tianjin Kailiqi Biotechnology Co., Ltd.
|
| Tel: |
15076683720 |
| Email: |
klq@cw-bio.com |
| Products Intro: |
Product Name:2-((3-Carboxypropanoyl)oxy)-N,N,N-trimethylethanaminium chloride
CAS:5297-17-6
Purity:大于96% Package:1g,5g,10g,25g根据客户需要分装 Remarks:Not For Human Use, Lab Use Only.
|
|
| | Succinylmonocholine Chloride (125 mg) Basic information |
| Product Name: | Succinylmonocholine Chloride (125 mg) | | Synonyms: | Succinylmonocholine chloride;Succinylmonocholine Chloride (125 mg);2-(3-Carboxy-1-oxopropoxy)-N,N,N-trimethylethanaminium chloride;{2-[(3-Carboxypropanoyl)oxy]ethyl}trimethylazanium chloride;2-((3-Carboxypropanoyl)oxy)-N,N,N-trimethylethanaminium chloride;Citicoline Impurity 17;Succinylmonocholine Chloride (50 mg);Ethanaminium, 2-(3-carboxy-1-oxopropoxy)-N,N,N-trimethyl-, chloride (1:1) | | CAS: | 5297-17-6 | | MF: | C9H18NO4.Cl | | MW: | 239.7 | | EINECS: | | | Product Categories: | | | Mol File: | 5297-17-6.mol |  |
| | Succinylmonocholine Chloride (125 mg) Chemical Properties |
| Melting point | 150-151 °C(Solv: ethanol (64-17-5)) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | solid | | Stability: | Hygroscopic | | Major Application | pharmaceutical small molecule | | InChI | 1S/C9H17NO4.ClH/c1-10(2,3)6-7-14-9(13)5-4-8(11)12;/h4-7H2,1-3H3;1H | | InChIKey | LDHMZIUMVSRSIK-UHFFFAOYSA-N | | SMILES | Cl.[N+](CCOC(=O)CCC(=O)[O-])(C)(C)C |
| WGK Germany | WGK 3 | | HS Code | 2923900100 | | Storage Class | 11 - Combustible Solids |
| | Succinylmonocholine Chloride (125 mg) Usage And Synthesis |
| Uses | {2-[(3-Carboxypropanoyl)oxy]ethyl}trimethylazanium Chloride can be used for neuromuscular blocking action of succinylmonocholine in the rat. |
| | Succinylmonocholine Chloride (125 mg) Preparation Products And Raw materials |
|