|
|
| | (S) - 1 - tert - Butyl 2 - Methyl 5 - oxopiperidine - 1,2 - dicarboxylate Basic information |
| Product Name: | (S) - 1 - tert - Butyl 2 - Methyl 5 - oxopiperidine - 1,2 - dicarboxylate | | Synonyms: | (S) - 1 - tert - Butyl 2 - Methyl 5 - oxopiperidine - 1,2 - dicarboxylate;1-tert-butyl 2-methyl (2S)-5-oxopiperidine-1,2-dicarboxylate;1,2-Piperidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) 2-methyl ester, (2S)-;Methyl (S)-1-Boc-5-oxopiperidine-2-carboxylate;1-tert-Butyl 2-methyl (2S)-5-oxopiperidine-1,2-dicarboxylate - [B15615] | | CAS: | 915976-31-7 | | MF: | C12H19NO5 | | MW: | 257.28 | | EINECS: | | | Product Categories: | | | Mol File: | 915976-31-7.mol |  |
| | (S) - 1 - tert - Butyl 2 - Methyl 5 - oxopiperidine - 1,2 - dicarboxylate Chemical Properties |
| Boiling point | 350.0±42.0 °C(Predicted) | | density | 1.175±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -3.71±0.40(Predicted) | | InChI | InChI=1S/C12H19NO5/c1-12(2,3)18-11(16)13-7-8(14)5-6-9(13)10(15)17-4/h9H,5-7H2,1-4H3/t9-/m0/s1 | | InChIKey | UCRLFGKYCFXSEA-VIFPVBQESA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC(=O)CC[C@H]1C(OC)=O |
| | (S) - 1 - tert - Butyl 2 - Methyl 5 - oxopiperidine - 1,2 - dicarboxylate Usage And Synthesis |
| | (S) - 1 - tert - Butyl 2 - Methyl 5 - oxopiperidine - 1,2 - dicarboxylate Preparation Products And Raw materials |
|