|
|
| | O-TOLUENESULFONYL CHLORIDE Basic information |
| | O-TOLUENESULFONYL CHLORIDE Chemical Properties |
| Melting point | 10°C | | Boiling point | 254 °C(lit.) | | density | 1.320 g/mL at 25 °C(lit.) | | refractive index | n20/D >1.5580(lit.) | | Fp | >230 °F | | storage temp. | Store under inert gas | | solubility | Acetonitrile (Slightly), Chloroform(Slightly) | | form | clear liquid | | color | Colorless to Light yellow | | Water Solubility | Soluble in hot alcohol, ether and benzene. Reacts with water. | | Sensitive | Moisture Sensitive | | BRN | 973180 | | InChI | InChI=1S/C7H7ClO2S/c1-6-4-2-3-5-7(6)11(8,9)10/h2-5H,1H3 | | InChIKey | HDECRAPHCDXMIJ-UHFFFAOYSA-N | | SMILES | C1(S(Cl)(=O)=O)=CC=CC=C1C | | CAS DataBase Reference | 133-59-5(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonyl chloride, 2-methyl- (133-59-5) |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 2904100090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B | | Hazardous Substances Data | 133-59-5(Hazardous Substances Data) |
| | O-TOLUENESULFONYL CHLORIDE Usage And Synthesis |
| Chemical Properties | Oily liquid. Melting point 10.2°C, boiling point 154°C (4.8kPa), 126°C (1.33kPa), relative density 1.3383 (20/4°C), refractive index 1.5565. soluble in hot alcohols, ethers, benzene, insoluble in water. | | Uses | o-Toluenesulfonyl chloride is used in organic synthesis and saccharin production. It is also used as pharmaceutical intermediate. | | Uses | o-Toluenesulfonyl chloride may be used in the synthesis of:
- oxazoline
- mesityl o-tolyl sulfone
- allyl o-toluenesulfonate
- 2-methyl-4′-t-butyldiphenyl sulfone
| | General Description | o-Toluenesulfonyl chloride can be synthesized by reacting o-thiocresol in glacial acetic acid with chlorine. It participates in the preparation of 5-chloro-3-phenyl-2,1-benzisoxazole. |
| | O-TOLUENESULFONYL CHLORIDE Preparation Products And Raw materials |
|