3,3-DiMethyl-cyclopentanone manufacturers
|
| | 3,3-DiMethyl-cyclopentanone Basic information |
| Product Name: | 3,3-DiMethyl-cyclopentanone | | Synonyms: | 3,3-DiMethyl-cyclopentanone;Cyclopentanone, 3,3-dimethyl-;3,3-di methyl cyclopentan-1-one;3,3-dimethylcyclopentanone - [D84554] | | CAS: | 20500-49-6 | | MF: | C7H12O | | MW: | 112.17 | | EINECS: | | | Product Categories: | | | Mol File: | 20500-49-6.mol |  |
| | 3,3-DiMethyl-cyclopentanone Chemical Properties |
| Boiling point | 153-154 °C | | density | 0.907±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H12O/c1-7(2)4-3-6(8)5-7/h3-5H2,1-2H3 | | InChIKey | JSYAQLZSGHPSJD-UHFFFAOYSA-N | | SMILES | C1(=O)CCC(C)(C)C1 |
| | 3,3-DiMethyl-cyclopentanone Usage And Synthesis |
| Uses | 3,3-Dimethylcyclopentanone is an intermediate used in the total synthesis of tremulenolide A and tremulenediol A via cyclopropanation/Cope rearrangement. | | Synthesis Reference(s) | Synthesis, p. 330, 1995 DOI: 10.1055/s-1995-3909
Tetrahedron Letters, 35, p. 7217, 1994 DOI: 10.1016/0040-4039(94)85364-9 |
| | 3,3-DiMethyl-cyclopentanone Preparation Products And Raw materials |
|