|
|
| | 2-butyl-6-Methoxy-naphthalene Basic information |
| | 2-butyl-6-Methoxy-naphthalene Chemical Properties |
| Melting point | 62-65°C | | Boiling point | 332.6±11.0 °C(Predicted) | | density | 1.004±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform, Ethyl Acetate | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C15H18O/c1-3-4-5-12-6-7-14-11-15(16-2)9-8-13(14)10-12/h6-11H,3-5H2,1-2H3 | | InChIKey | BJLRUUACNLOUQG-UHFFFAOYSA-N | | SMILES | C1=C2C(C=C(OC)C=C2)=CC=C1CCCC |
| | 2-butyl-6-Methoxy-naphthalene Usage And Synthesis |
| Uses | 2-Butyl-6-methoxynaphthalene is an impurity of Nabumetone (N200500), an anti-inflammatory and antibacterial agent. |
| | 2-butyl-6-Methoxy-naphthalene Preparation Products And Raw materials |
|