|
|
| | 1-Ethyl-3-methylimidazolium tetrafluoroborate Basic information |
| | 1-Ethyl-3-methylimidazolium tetrafluoroborate Chemical Properties |
| Melting point | 15 °C (lit.) | | Boiling point | >350 °C (lit.) | | density | 1.294 g/mL at 25 °C (lit.) | | vapor pressure | 0-0Pa at 20-25℃ | | refractive index | n20/D 1.413(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | color | Colorless to Light orange to Yellow | | Sensitive | Hygroscopic | | InChI | InChI=1S/C6H11N2.BF4/c1-3-8-5-4-7(2)6-8;2-1(3,4)5/h4-6H,3H2,1-2H3;/q+1;-1 | | InChIKey | RNBAQXLNJMVTCI-UHFFFAOYSA-M | | SMILES | [B-](F)(F)(F)F.N1(CC)C=C[N+](C)=C1 | | CAS DataBase Reference | 143314-16-3(CAS DataBase Reference) | | ECW | 3.6 - 4.0 V |
| Hazard Codes | Xn,N | | Risk Statements | 36/38-51/53-22-24/25-23 | | Safety Statements | 23-24/25-61 | | RIDADR | UN3082 9/PG 3 | | WGK Germany | 3 | | F | 3-10 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29332900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |
| | 1-Ethyl-3-methylimidazolium tetrafluoroborate Usage And Synthesis |
| Conductivity | 14.1 mS/cm (25 °C) | | Chemical Properties | Light yellow liquid | | Uses | 1-Ethyl-3-methylimidazolium tetrafluoroborate is a room temperature ionic liquid widely used as an electrolyte in electrochemical studies. Its diffusion coefficient, 13C spin-lattice relaxation times, and nuclear Overhauser enhancements have been analyzed using NMR techniques to study its hydrogen bonding. Some of its fundamental physical and chemical properties such as density, viscosity, thermal stability, surface tension, refractive index and pH have been studied over a wide range of temperature. | | Uses | The enzymatic resolution of homophenylalanine ester to form enantiomeric homophenylalanine can be performed using 1-ethyl-3-methylimidazolium tetrafluoroborate as a reaction medium. | | Uses | 1-Ethyl-3-methylimidazolium tetrafluoroborate is an ionic liquid used in the recycling of osmium in the dihydroxylation of olefins with osmium(VIII) oxide. It is a stable liquid electrolyte used in the capillary electrophoretic method for resolving phenolic compounds present in grape seed extract. It also acts as a good solvent for a wide range of both organic and inorganic compounds. | | General Description | 1-Ethyl-3-methylimidazolium tetrafluoroborate is an air and water stable, room temperature ionic liquid (RTIL). It can be prepared by reacting 1-ethyl-3-methylimidazolium bromide with tetrafluoroboric acid. |
| | 1-Ethyl-3-methylimidazolium tetrafluoroborate Preparation Products And Raw materials |
|