| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | H-b-HoLys-OH·2HCl Basic information |
| Product Name: | H-b-HoLys-OH·2HCl | | Synonyms: | (3S)-3,7-diaminoheptanoic acid dihydrochloride;L-beta-Homolysine dihydrochloride >=98.0% (TLC);L-β-Homo-Lys-OH.2HCl;L-β-Homolysine dihydrochloride;H-L-b-HoLys-OH·2HCl;β-HoLys-OH·2HCl;H-L-β-HoLys-OH·2HCl;L?Homolysine dihydrochloride | | CAS: | 290835-83-5 | | MF: | C7H18Cl2N2O2 | | MW: | 233.13602 | | EINECS: | | | Product Categories: | | | Mol File: | 290835-83-5.mol |  |
| | H-b-HoLys-OH·2HCl Chemical Properties |
| solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | Beige | | Major Application | peptide synthesis | | InChI | 1S/C7H16N2O2.2ClH/c8-4-2-1-3-6(9)5-7(10)11;;/h6H,1-5,8-9H2,(H,10,11);2*1H/t6-;;/m0../s1 | | InChIKey | APJAFTBCSGCCAH-ILKKLZGPSA-N | | SMILES | Cl.Cl.NCCCC[C@H](N)CC(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | H-b-HoLys-OH·2HCl Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | H-b-HoLys-OH·2HCl Preparation Products And Raw materials |
|