| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | 3-Amino-3-deoxydigoxigenin hemisuccinamide, succinimidyl ester Basic information |
| | 3-Amino-3-deoxydigoxigenin hemisuccinamide, succinimidyl ester Chemical Properties |
| storage temp. | −20°C | | form | solid | | color | white | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChIKey | AVQGRLJRQILBRQ-ZCIIQETRSA-N | | SMILES | C[C@]12CC[C@@H](C[C@H]1CC[C@@H]3[C@@H]2C[C@@H](O)[C@]4(C)[C@H](CC[C@]34O)C5=CC(=O)OC5)NC(=O)CCC(=O)ON6C(=O)CCC6=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3-Amino-3-deoxydigoxigenin hemisuccinamide, succinimidyl ester Usage And Synthesis |
| Uses | Amine-reactive haptenylation reagent. This succinimidyl ester derivative of digoxigenin has been shown to inhibit the Na+/K+- ATPase by binding to the cardiac steroid receptor site. |
| | 3-Amino-3-deoxydigoxigenin hemisuccinamide, succinimidyl ester Preparation Products And Raw materials |
|