| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(S)-3-(Boc-aMino)-2,4-diMethyl-2-pentanol
CAS:157035-77-3
Purity:97% Package:1G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(S)-3-(Boc-amino)-2,4-dimethyl-2-pentanol
CAS:157035-77-3
Purity:97% Package:1G Remarks:719293-1G
|
| Company Name: |
Beijing Famozi Pharmaceutical Technology Co., Ltd
|
| Tel: |
15811073878 |
| Email: |
2559355526@qq.com |
| Products Intro: |
Product Name:tert-butyl (S)-(2-hydroxy-2,4-dimethylpentan-3-yl)carbamate
CAS:157035-77-3
Purity:97% Package:1g;5g;10g;25g;50g;100g;250g;500g;1kg;5kg;10kg;25kg;50kg;100kg;250kg;500kg
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:(S)-3-(Boc-amino)-2,4-dimethyl-2-pentanol
CAS:157035-77-3
|
|
| | (S)-3-(Boc-aMino)-2,4-diMethyl-2-pentanol Basic information |
| Product Name: | (S)-3-(Boc-aMino)-2,4-diMethyl-2-pentanol | | Synonyms: | (S)-3-(Boc-aMino)-2,4-diMethyl-2-pentanol;Carbamic acid, N-[(1S)-2-hydroxy-2-methyl-1-(1-methylethyl)propyl]-, 1,1-dimethylethyl ester;tert-butyl (S)-(2-hydroxy-2,4-dimethylpentan-3-yl)carbamate;(S)-3-(Boc-amino)-2,4-dimethyl-2-pentanol | | CAS: | 157035-77-3 | | MF: | C12H25NO3 | | MW: | 231.33 | | EINECS: | | | Product Categories: | | | Mol File: | 157035-77-3.mol |  |
| | (S)-3-(Boc-aMino)-2,4-diMethyl-2-pentanol Chemical Properties |
| Melting point | 54-60°C | | Boiling point | 324.4±25.0 °C(Predicted) | | density | 0.974±0.06 g/cm3(Predicted) | | Fp | >110℃ | | form | solid | | pka | 12.37±0.46(Predicted) | | Optical Rotation | [α]22/D 14.2°, c = 0.5 in chloroform | | InChI | 1S/C12H25NO3/c1-8(2)9(12(6,7)15)13-10(14)16-11(3,4)5/h8-9,15H,1-7H3,(H,13,14)/t9-/m0/s1 | | InChIKey | AWLRFWWWKJXWTQ-VIFPVBQESA-N | | SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(C)(C)O |
| Hazard Codes | T | | Risk Statements | 25-52/53 | | Safety Statements | 45-61 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | (S)-3-(Boc-aMino)-2,4-diMethyl-2-pentanol Usage And Synthesis |
| Uses | (S)-3-(Boc-amino)-2,4-dimethyl-2-pentanol can be used as an intermediate to prepare:
- Tris(4S-isopropyl-5,5-dimethyl-2-oxazolinyl)phenylborate ligand, applicable in the synthesis of various metal complexes bearing catalyst properties.
- Hydroxy isocyanides, important building blocks for the synthesis of (hydroxyalkyl)oxazoline ligands.
|
| | (S)-3-(Boc-aMino)-2,4-diMethyl-2-pentanol Preparation Products And Raw materials |
|