|
|
| | (3R,4R)-4-aMino-3-hydroxy-piperidine-1-carboxylic acid tert-butyl ester Basic information |
| Product Name: | (3R,4R)-4-aMino-3-hydroxy-piperidine-1-carboxylic acid tert-butyl ester | | Synonyms: | CPD3650;(3R,4R)-1-Boc-4-amino-3-hydroxy-piperidine;(3R,4R)-4-aMino-3-hydroxy-piperidine-1-carboxylic acid tert-butyl ester;(3R,4R)-4-AMINO-1-BOC-3-HYDROXYPIPERIDINE;(3R,4R)-tert-Butyl 4-amino-3-hydroxypiperidine-1-carboxylate;1-Piperidinecarboxylic acid, 4-amino-3-hydroxy-, 1,1-dimethylethyl ester, (3R,4R)-;t-Butyl (3R,4R)-4-amino-3-hydroxypiperidine-1-carboxylate;(3R,4R)-4-Amino-1-Boc-piperidin-3-ol | | CAS: | 1007596-95-3 | | MF: | C10H20N2O3 | | MW: | 216.28 | | EINECS: | | | Product Categories: | | | Mol File: | 1007596-95-3.mol |  |
| | (3R,4R)-4-aMino-3-hydroxy-piperidine-1-carboxylic acid tert-butyl ester Chemical Properties |
| Boiling point | 326.1±42.0 °C(Predicted) | | density | 1.142±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 14.37±0.40(Predicted) | | Appearance | Colorless to light yellow Viscous Liquid | | Optical Rotation | 4.7900°(C=1g/100ml MEOH) | | InChI | InChI=1S/C10H20N2O3/c1-10(2,3)15-9(14)12-5-4-7(11)8(13)6-12/h7-8,13H,4-6,11H2,1-3H3/t7-,8-/m1/s1 | | InChIKey | KREUZCYJWPQPJX-HTQZYQBOSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC[C@@H](N)[C@H](O)C1 |
| | (3R,4R)-4-aMino-3-hydroxy-piperidine-1-carboxylic acid tert-butyl ester Usage And Synthesis |
| | (3R,4R)-4-aMino-3-hydroxy-piperidine-1-carboxylic acid tert-butyl ester Preparation Products And Raw materials |
|