3,3-Dimethylindoline manufacturers
|
| | 3,3-Dimethylindoline Basic information | | Uses |
| Product Name: | 3,3-Dimethylindoline | | Synonyms: | 3,3-diMethyl-2,3-dihydro-1H-indole;2,3-Dihydro-3,3-dimethyl-1H-indole;3,3-dimethyl-1,2-dihydroindole;1H-Indole, 2,3-dihydro-3,3-dimethyl-;3,3-dimethylindoline | | CAS: | 1914-02-9 | | MF: | C10H13N | | MW: | 147.22 | | EINECS: | | | Product Categories: | | | Mol File: | 1914-02-9.mol |  |
| | 3,3-Dimethylindoline Chemical Properties |
| Melting point | 34 °C | | Boiling point | 60 °C(Press: 2 Torr) | | density | 0.962±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | solid | | pka | 5.28±0.40(Predicted) | | color | Light yellow | | InChI | InChI=1S/C10H13N/c1-10(2)7-11-9-6-4-3-5-8(9)10/h3-6,11H,7H2,1-2H3 | | InChIKey | SRCCLYMWDRNUAF-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C(C)(C)C1 |
| | 3,3-Dimethylindoline Usage And Synthesis |
| Uses | 3,3-Dimethylindoline is a heterocyclic derivative and can be used as a pharmaceutical intermediate. |
| | 3,3-Dimethylindoline Preparation Products And Raw materials |
|