| Company Name: |
Henan Yinuokai New Materials Co., Ltd Gold
|
| Tel: |
15565215982 |
| Email: |
15565215982@163.com |
| Products Intro: |
Product Name:4,4,5,5-tetraMethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane CAS:174090-36-9 Purity:98% Package:1g;5g;25g
|
| Company Name: |
Changzhou Hopschain Chemical Co.,Ltd.
|
| Tel: |
0519-85528066 13775048983 |
| Email: |
sales@hopschem.com |
| Products Intro: |
Product Name:2-(1-PHENYLETHYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE CAS:174090-36-9 Purity:97+% Package:1g;5g
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-58859352 18068836627 |
| Email: |
sales01@aikonchem.com |
| Products Intro: |
Product Name:4,4,5,5-Tetramethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane CAS:174090-36-9 Purity:95+% Package:1g;5g;10g
|
| Company Name: |
Nanjing Shizhou Biology Technology Co.,Ltd
|
| Tel: |
025-025-85560043 17301488900 |
| Email: |
info@synzest.com |
| Products Intro: |
Product Name:4,4,5,5-tetramethyl-2-(1-phenylethyl)-1,3,2-dioxab
orolane CAS:174090-36-9 Purity:95% Package:1g;5g;10g
|
|
| | 4,4,5,5-tetraMethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane Basic information |
| Product Name: | 4,4,5,5-tetraMethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane | | Synonyms: | 4,4,5,5-tetraMethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane;2-(1-PHENYLETHYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE;1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(1-phenylethyl)- | | CAS: | 174090-36-9 | | MF: | C14H21BO2 | | MW: | 232.13 | | EINECS: | | | Product Categories: | | | Mol File: | 174090-36-9.mol |  |
| | 4,4,5,5-tetraMethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane Chemical Properties |
| Boiling point | 278.2±19.0 °C(Predicted) | | density | 0.97±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | InChI | InChI=1S/C14H21BO2/c1-11(12-9-7-6-8-10-12)15-16-13(2,3)14(4,5)17-15/h6-11H,1-5H3 | | InChIKey | VNYHYPMNRXFAAP-UHFFFAOYSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1C(C1=CC=CC=C1)C |
| | 4,4,5,5-tetraMethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane Usage And Synthesis |
| | 4,4,5,5-tetraMethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane Preparation Products And Raw materials |
|