|
|
| | 4,4,5,5-tetraMethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane Basic information |
| Product Name: | 4,4,5,5-tetraMethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane | | Synonyms: | 4,4,5,5-tetraMethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane;2-(1-PHENYLETHYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE;1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(1-phenylethyl)-;1-Phenylethylboronic Acid Pinacol Ester | | CAS: | 174090-36-9 | | MF: | C14H21BO2 | | MW: | 232.13 | | EINECS: | | | Product Categories: | | | Mol File: | 174090-36-9.mol |  |
| | 4,4,5,5-tetraMethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane Chemical Properties |
| Boiling point | 278.2±19.0 °C(Predicted) | | density | 0.97±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | InChI | InChI=1S/C14H21BO2/c1-11(12-9-7-6-8-10-12)15-16-13(2,3)14(4,5)17-15/h6-11H,1-5H3 | | InChIKey | VNYHYPMNRXFAAP-UHFFFAOYSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1C(C1=CC=CC=C1)C |
| | 4,4,5,5-tetraMethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane Usage And Synthesis |
| | 4,4,5,5-tetraMethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane Preparation Products And Raw materials |
|