8-CHLORO-CAMP manufacturers
- Tocladesine
-
- $1520.00
-
2026-05-11
- CAS:41941-56-4
- Purity:
- Supply Ability: 10g
|
| | 8-CHLORO-CAMP Basic information |
| Product Name: | 8-CHLORO-CAMP | | Synonyms: | 8-CHLOROADENOSINE-CYCLIC-3',5'-MONOPHOSPHATE;8-CHLORO-CAMP;8-CL-CAMP;8-CHLOROADENOSINE 3',5'-CYCLIC-MONOPHOSPHATE;8-Chloro-cAMP, 8-Chloroadenosine 3μ,5μ-monophosphate, 8-Cl-cAMP;8-Chloro cyclic adenosine 3',5'-phosphate;8-Chloroadenosine 3',5'-phosphoric acid;8-Chloroadenosine 3',5'-Cyclicmonophate Sodium Salt | | CAS: | 41941-56-4 | | MF: | C10H11ClN5O6P | | MW: | 363.65 | | EINECS: | | | Product Categories: | | | Mol File: | 41941-56-4.mol |  |
| | 8-CHLORO-CAMP Chemical Properties |
| Boiling point | 731.7±70.0 °C(Predicted) | | density | 2.55±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | aqueous base: soluble | | form | White to off-white powder. | | pka | 0.95±0.60(Predicted) | | color | White to light yellow | | InChI | 1S/C10H11ClN5O6P/c11-10-15-4-7(12)13-2-14-8(4)16(10)9-5(17)6-3(21-9)1-20-23(18,19)22-6/h2-3,5-6,9,17H,1H2,(H,18,19)(H2,12,13,14) | | InChIKey | CLLFEJLEDNXZNR-UHFFFAOYSA-N | | SMILES | Nc1ncnc2n(C3OC4COP(O)(=O)OC4C3O)c(Cl)nc12 |
| WGK Germany | 3 | | RTECS | AU7357552 | | Storage Class | 11 - Combustible Solids |
| | 8-CHLORO-CAMP Usage And Synthesis |
| Uses | 8-Chloroadenosine 3'',5''-Cyclic Monophosphate is a cAMP analog with high selectivity for PKA I. Used in anti-cancer treatments. | | Biological Activity | Membrane-permeable cAMP analog; resistant to hydrolysis by phosphodiesterases. | | in vivo | In rat bearing balloon injury, 8-Chloro-cAMP (12 mg/kg) reduces, in a dose-dependent manner, neointimal area and neointima/media ratio after balloon injury. 8-Chloro-cAMP shows a reduction of proliferative activity of VSMCs in vivo[1]. |
| | 8-CHLORO-CAMP Preparation Products And Raw materials |
|