| Company Name: |
Hubei Jusheng Technology Co.,Ltd. |
| Tel: |
18871490254 |
| Email: |
linda@hubeijusheng.com |
| Products Intro: |
Product Name:1H-Indeno[5,4-f]quinoline-7-carboxamide, N-[2,5-bis(trifluoromethyl)phenyl]-2,4a,4b,5,6,6a,7,8,9,9a,9b,10,11,11a-tetradecahydro-4a,6a-dimethyl-2-oxo-, (4aR,4bS,6aS,7S,9aS,9bS,11aS)-
CAS:957229-52-6
Purity:0.99 Package:5KG;1KG Remarks:C27H30F6N2O2
|
|
|
|
|
- 5β-?Dutasteride
-
- $2500.00 / 100mg
-
2025-10-27
- CAS:957229-52-6
- Min. Order:
- Purity:
- Supply Ability: 10g
- 5β-Dutasteride
-
- $1.00 / 1KG
-
2020-03-12
- CAS:957229-52-6
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 100kg
|
| | 5β-Dutasteride Basic information |
| Product Name: | 5β-Dutasteride | | Synonyms: | 5β-Dutasteride;5-Beta-Dutasteride;1H-Indeno[5,4-f]quinoline-7-carboxamide, N-[2,5-bis(trifluoromethyl)phenyl]-2,4a,4b,5,6,6a,7,8,9,9a,9b,10,11,11a-tetradecahydro-4a,6a-dimethyl-2-oxo-, (4aR,4bS,6aS,7S,9aS,9bS,11aS)-;5β-Dutasteride Impurity;5β?Dutasteride,5β ?Dutasteride;5β-Dutasteride | | CAS: | 957229-52-6 | | MF: | C27H30F6N2O2 | | MW: | 528.5297192 | | EINECS: | | | Product Categories: | Impurities;Intermediates & Fine Chemicals;Pharmaceuticals;Steroids;Impurities, Pharmaceuticals, Intermediates & Fine Chemicals, Steroids | | Mol File: | 957229-52-6.mol |  |
| | 5β-Dutasteride Chemical Properties |
| Melting point | >292°C (dec.) | | Boiling point | 620.3±55.0 °C(Predicted) | | density | 1.303±0.06 g/cm3(Predicted) | | storage temp. | -20°C, Inert atmosphere | | solubility | DMSO (Slightly) | | pka | 13.32±0.70(Predicted) | | form | Solid | | color | White to Off-White | | InChIKey | JWJOTENAMICLJG-LKOHVCGWSA-N | | SMILES | N1[C@]2([H])[C@@](C)([C@@]3([H])CC[C@@]4(C)[C@]([H])([C@]3([H])CC2)CC[C@@H]4C(NC2=CC(C(F)(F)F)=CC=C2C(F)(F)F)=O)C=CC1=O |
| | 5β-Dutasteride Usage And Synthesis |
| Uses | 5β-Dutasteride is the β-isomer impurity of Dutasteride (D735000), a dual inhibitor of 5α-reductase isoenzymes type 1 and 2. |
| | 5β-Dutasteride Preparation Products And Raw materials |
|