|
|
| | 4-tert-ButylaMinoethyl-2-Methylphenol Basic information |
| | 4-tert-ButylaMinoethyl-2-Methylphenol Chemical Properties |
| Melting point | 124-126°C | | Boiling point | 317.4±27.0 °C(Predicted) | | density | 0.978±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 10.24±0.20(Predicted) | | color | White to Off-White | | Major Application | pharmaceutical | | InChI | 1S/C13H21NO/c1-10-9-11(5-6-12(10)15)7-8-14-13(2,3)4/h5-6,9,14-15H,7-8H2,1-4H3 | | InChIKey | NZVRVWRGZWEPRX-UHFFFAOYSA-N | | SMILES | N(C(C)(C)C)CCc1cc(c(cc1)O)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-tert-ButylaMinoethyl-2-Methylphenol Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 4-tert-Butylaminoethyl-2-methylphenol is an impurity of Albuterol Sulfate (Salbutamol Sulfate) (A514500). Albuterol impurity H. |
| | 4-tert-ButylaMinoethyl-2-Methylphenol Preparation Products And Raw materials |
|