|
|
| | 2-Methyl-D-proline methyl ester hydrochloride Basic information |
| Product Name: | 2-Methyl-D-proline methyl ester hydrochloride | | Synonyms: | 2-Methyl-D-proline methyl ester hydrochloride;methyl (2R)-2-methylpyrrolidine-2-carboxylate hydrochloride;D-Proline, 2-methyl-, methyl ester, hydrochloride (1:1);2-Methyl-D-proline methyl ester HCl;methyl (R)-2-methylpyrrolidine-2-carboxylate hydrochloride;(R)-Methyl 2-methylpyrrolidine-2-carboxylate hydrochloride | | CAS: | 1286768-32-8 | | MF: | C7H14ClNO2 | | MW: | 179.64 | | EINECS: | | | Product Categories: | | | Mol File: | 1286768-32-8.mol |  |
| | 2-Methyl-D-proline methyl ester hydrochloride Chemical Properties |
| storage temp. | Store at room temperature, keep dry and cool | | Appearance | Light brown to brown Solid | | InChI | InChI=1/C7H13NO2.ClH/c1-7(6(9)10-2)4-3-5-8-7;/h8H,3-5H2,1-2H3;1H/t7-;/s3 | | InChIKey | YCYWAVUCBMJUPK-WMASNCOMNA-N | | SMILES | C([C@@]1(NCCC1)C)(=O)OC.Cl |&1:1,r| |
| | 2-Methyl-D-proline methyl ester hydrochloride Usage And Synthesis |
| | 2-Methyl-D-proline methyl ester hydrochloride Preparation Products And Raw materials |
|