4-broMo-6-chloronicotinic acid manufacturers
|
| | 4-broMo-6-chloronicotinic acid Basic information |
| Product Name: | 4-broMo-6-chloronicotinic acid | | Synonyms: | 4-broMo-6-chloronicotinic acid;4-bromo-6-chloropyridine-3-carboxylic acid;3-Pyridinecarboxylic acid, 4-bromo-6-chloro-;6-chloro-4-bromonicotinic acid | | CAS: | 1256834-13-5 | | MF: | C6H3BrClNO2 | | MW: | 236.45 | | EINECS: | | | Product Categories: | | | Mol File: | 1256834-13-5.mol |  |
| | 4-broMo-6-chloronicotinic acid Chemical Properties |
| Boiling point | 365.0±42.0 °C(Predicted) | | density | 1.917±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 1.89±0.10(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C6H3BrClNO2/c7-4-1-5(8)9-2-3(4)6(10)11/h1-2H,(H,10,11) | | InChIKey | FMQKQSCHFALFKI-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=CC(Br)=C1C(O)=O |
| | 4-broMo-6-chloronicotinic acid Usage And Synthesis |
| Uses | 4-Bromo-6-chloronicotinic Acid may be useful in the preparation of naphthyridine derivatives and related heterocycles for treatment of BAF-mediated disorders such as viral infections and cancer. |
| | 4-broMo-6-chloronicotinic acid Preparation Products And Raw materials |
|