| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | 25-HydroxyluMisterol3 Basic information |
| Product Name: | 25-HydroxyluMisterol3 | | Synonyms: | 25-HydroxyluMisterol3;IMpurity A of Calcifediol;(3S,9R,10S,13R,14R,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol;9β,10α-cholesta-5,7-diene-3β,25-diol;Calcifediol EP Impurity A/9β,10α-cholesta-5,7-
diene-3β,25-diol;Calcifediol Impurity 1(Calcifediol EP Impurity A);Calcifediol EP Impurity A;Cholesta-5,7-diene-3,25-diol, (3β,9β,10α)- (9CI) | | CAS: | 61585-29-3 | | MF: | C27H44O2 | | MW: | 400.65 | | EINECS: | | | Product Categories: | | | Mol File: | 61585-29-3.mol |  |
| | 25-HydroxyluMisterol3 Chemical Properties |
| Boiling point | 527.0±43.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | pka | 14.91±0.70(Predicted) | | InChIKey | JJFYNCJHSCTBPW-CEEMJFACNA-N | | SMILES | C[C@]12CC[C@@]3([H])[C@@]4(CC[C@H](O)CC4=CC=C3[C@]1([H])CC[C@]2([H])[C@H](C)CCCC(O)(C)C)C |&1:1,4,6,9,16,20,22,r| |
| | 25-HydroxyluMisterol3 Usage And Synthesis |
| Uses | 25-Hydroxylumisterol (Cholesterol Impurity 7) is an impurity of Cholesterol, which is a major component of all biological membranes. Cholesterol is the principal sterol of the higher animals. Cholesterol was found in all body tissues, especial in the brain, spinal cord, and in animal fats or oils. |
| | 25-HydroxyluMisterol3 Preparation Products And Raw materials |
|